C22H27FN3O2+ — CID 7253672
3-[[(Z)-3-(2-fluorophenyl)-2-[(4-methylbenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium (PubChem CID 7253672) has the molecular formula C22H27FN3O2+ and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-[[(Z)-3-(2-fluorophenyl)-2-[(4-methylbenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(Z)-3-(2-fluorophenyl)-2-[(4-methylbenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7253672 |
| Molecular Formula | C22H27FN3O2+ |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 3-[[(Z)-3-(2-fluorophenyl)-2-[(4-methylbenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium |
| SMILES | Cc1ccc(C(=O)N/C(=C\c2ccccc2F)C(=O)NCCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C22H26FN3O2/c1-16-9-11-17(12-10-16)21(27)25-20(15-18-7-4-5-8-19(18)23)22(28)24-13-6-14-26(2)3/h4-5,7-12,15H,6,13-14H2,1-3H3,(H,24,28)(H,25,27)/p+1/b20-15- |
| InChIKey | YJCNSSMOUSTLCC-HKWRFOASSA-O |
| XLogP | 1.56 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|