C21H24FN4O4+ — CID 7033191
3-[[(Z)-3-(2-fluorophenyl)-2-[(4-nitrobenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium (PubChem CID 7033191) has the molecular formula C21H24FN4O4+ and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[[(Z)-3-(2-fluorophenyl)-2-[(4-nitrobenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(Z)-3-(2-fluorophenyl)-2-[(4-nitrobenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7033191 |
| Molecular Formula | C21H24FN4O4+ |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-[[(Z)-3-(2-fluorophenyl)-2-[(4-nitrobenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=O)/C(=C/c1ccccc1F)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23FN4O4/c1-25(2)13-5-12-23-21(28)19(14-16-6-3-4-7-18(16)22)24-20(27)15-8-10-17(11-9-15)26(29)30/h3-4,6-11,14H,5,12-13H2,1-2H3,(H,23,28)(H,24,27)/p+1/b19-14- |
| InChIKey | FLUSMUDYLSCLCG-RGEXLXHISA-O |
| XLogP | 1.16 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|