C23H19BrFN3O2 — CID 19057689
N-[(Z)-3-[(2-aminophenyl)methylamino]-1-(5-bromo-2-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19057689) has the molecular formula C23H19BrFN3O2 and a molecular weight of 468.33 g/mol. Its IUPAC name is N-[(Z)-3-[(2-aminophenyl)methylamino]-1-(5-bromo-2-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2-aminophenyl)methylamino]-1-(5-bromo-2-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19057689 |
| Molecular Formula | C23H19BrFN3O2 |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | N-[(Z)-3-[(2-aminophenyl)methylamino]-1-(5-bromo-2-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Nc1ccccc1CNC(=O)/C(=C/c1cc(Br)ccc1F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19BrFN3O2/c24-18-10-11-19(25)17(12-18)13-21(28-22(29)15-6-2-1-3-7-15)23(30)27-14-16-8-4-5-9-20(16)26/h1-13H,14,26H2,(H,27,30)(H,28,29)/b21-13- |
| InChIKey | JEZUMQGZTIGVGU-BKUYFWCQSA-N |
| XLogP | 4.26 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|