C22H20N4O3 — CID 9334358
(E)-2-cyano-3-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide (PubChem CID 9334358) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9334358 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (E)-2-cyano-3-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1ccco1)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C22H20N4O3/c23-13-16(22(27)24-14-19-8-4-10-28-19)12-17-15-26(18-6-2-1-3-7-18)25-21(17)20-9-5-11-29-20/h1-3,5-7,9,11-12,15,19H,4,8,10,14H2,(H,24,27)/b16-12+/t19-/m1/s1 |
| InChIKey | NEHIDZRCGFWFEO-APEZIOSESA-N |
| XLogP | 3.33 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|