C14H17BrN2O3 — CID 99700386
N-(3-bromophenyl)-N'-methyl-N'-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 99700386) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-methyl-N'-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N-(3-bromophenyl)-N'-methyl-N'-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 99700386 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-(3-bromophenyl)-N'-methyl-N'-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | CN(C[C@@H]1CCCO1)C(=O)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C14H17BrN2O3/c1-17(9-12-6-3-7-20-12)14(19)13(18)16-11-5-2-4-10(15)8-11/h2,4-5,8,12H,3,6-7,9H2,1H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | CLKOYBHTNSLWIW-LBPRGKRZSA-N |
| XLogP | 2.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|