C15H21BrN2O2 — CID 51108212
3-(4-bromo-2,6-dimethylphenyl)-1-methyl-1-(oxolan-2-ylmethyl)urea (PubChem CID 51108212) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenyl)-1-methyl-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 3-(4-bromo-2,6-dimethylphenyl)-1-methyl-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 51108212 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenyl)-1-methyl-1-(oxolan-2-ylmethyl)urea |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)N(C)CC1CCCO1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-10-7-12(16)8-11(2)14(10)17-15(19)18(3)9-13-5-4-6-20-13/h7-8,13H,4-6,9H2,1-3H3,(H,17,19) |
| InChIKey | FJQOETOLFLVJAC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |