C19H22N4O4 — CID 166231436
N'-ethyl-N'-(oxolan-2-ylmethyl)-N-(3-pyrimidin-2-yloxyphenyl)oxamide (PubChem CID 166231436) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is N'-ethyl-N'-(oxolan-2-ylmethyl)-N-(3-pyrimidin-2-yloxyphenyl)oxamide.
| Compound Name | N'-ethyl-N'-(oxolan-2-ylmethyl)-N-(3-pyrimidin-2-yloxyphenyl)oxamide |
|---|---|
| PubChem CID | 166231436 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N'-ethyl-N'-(oxolan-2-ylmethyl)-N-(3-pyrimidin-2-yloxyphenyl)oxamide |
| SMILES | CCN(CC1CCCO1)C(=O)C(=O)Nc1cccc(Oc2ncccn2)c1 |
| InChI | InChI=1S/C19H22N4O4/c1-2-23(13-16-8-4-11-26-16)18(25)17(24)22-14-6-3-7-15(12-14)27-19-20-9-5-10-21-19/h3,5-7,9-10,12,16H,2,4,8,11,13H2,1H3,(H,22,24) |
| InChIKey | MQCBZNPXGOOIRB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|