C23H28N2O5 — CID 43011182
N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 43011182) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 43011182 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)C(=O)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-3-25(15-22(26)24-18-6-4-7-20(14-18)28-2)23(27)17-9-11-19(12-10-17)30-16-21-8-5-13-29-21/h4,6-7,9-12,14,21H,3,5,8,13,15-16H2,1-2H3,(H,24,26) |
| InChIKey | VMSBIFSIIWQXCH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |