C21H23NO6 — CID 24518286
oxolan-2-ylmethyl 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 24518286) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is oxolan-2-ylmethyl 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | oxolan-2-ylmethyl 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 24518286 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | oxolan-2-ylmethyl 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)OCC3CCCO3)cc2)c1 |
| InChI | InChI=1S/C21H23NO6/c1-25-18-5-2-4-16(12-18)22-20(23)14-27-17-9-7-15(8-10-17)21(24)28-13-19-6-3-11-26-19/h2,4-5,7-10,12,19H,3,6,11,13-14H2,1H3,(H,22,23) |
| InChIKey | HEYCNUBPHUMGGV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |