C18H27N3O4 — CID 95259052
2-methylpropyl N-[3-[[methyl-[[(2S)-oxolan-2-yl]methyl]carbamoyl]amino]phenyl]carbamate (PubChem CID 95259052) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-methylpropyl N-[3-[[methyl-[[(2S)-oxolan-2-yl]methyl]carbamoyl]amino]phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[3-[[methyl-[[(2S)-oxolan-2-yl]methyl]carbamoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 95259052 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-methylpropyl N-[3-[[methyl-[[(2S)-oxolan-2-yl]methyl]carbamoyl]amino]phenyl]carbamate |
| SMILES | CC(C)COC(=O)Nc1cccc(NC(=O)N(C)C[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C18H27N3O4/c1-13(2)12-25-18(23)20-15-7-4-6-14(10-15)19-17(22)21(3)11-16-8-5-9-24-16/h4,6-7,10,13,16H,5,8-9,11-12H2,1-3H3,(H,19,22)(H,20,23)/t16-/m0/s1 |
| InChIKey | IOELUBCOIJMZEB-INIZCTEOSA-N |
| XLogP | 3.53 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |