C16H16F2N2O4 — CID 98449581
(2S)-2-cyano-3-[2-(difluoromethoxy)phenyl]-3-oxo-N-[[(2R)-oxolan-2-yl]methyl]propanamide (PubChem CID 98449581) has the molecular formula C16H16F2N2O4 and a molecular weight of 338.31 g/mol. Its IUPAC name is (2S)-2-cyano-3-[2-(difluoromethoxy)phenyl]-3-oxo-N-[[(2R)-oxolan-2-yl]methyl]propanamide.
| Compound Name | (2S)-2-cyano-3-[2-(difluoromethoxy)phenyl]-3-oxo-N-[[(2R)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 98449581 |
| Molecular Formula | C16H16F2N2O4 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2S)-2-cyano-3-[2-(difluoromethoxy)phenyl]-3-oxo-N-[[(2R)-oxolan-2-yl]methyl]propanamide |
| SMILES | N#C[C@H](C(=O)NC[C@H]1CCCO1)C(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H16F2N2O4/c17-16(18)24-13-6-2-1-5-11(13)14(21)12(8-19)15(22)20-9-10-4-3-7-23-10/h1-2,5-6,10,12,16H,3-4,7,9H2,(H,20,22)/t10-,12+/m1/s1 |
| InChIKey | IPQDAWOHHLQUSB-PWSUYJOCSA-N |
| XLogP | 1.91 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|