C28H33N3O4S2 — CID 4950951
4-heptoxy-N-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 4950951) has the molecular formula C28H33N3O4S2 and a molecular weight of 539.72 g/mol. Its IUPAC name is 4-heptoxy-N-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-heptoxy-N-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4950951 |
| Molecular Formula | C28H33N3O4S2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 4-heptoxy-N-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)N(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H33N3O4S2/c1-3-4-5-6-10-21-35-25-17-13-22(14-18-25)27(32)30-28(36)29-23-15-19-26(20-16-23)37(33,34)31(2)24-11-8-7-9-12-24/h7-9,11-20H,3-6,10,21H2,1-2H3,(H2,29,30,32,36) |
| InChIKey | AGAAHFZVCRBFHL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|