C26H35NO4 — CID 70409893
3-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-2-ethylphenyl]propanoic acid (PubChem CID 70409893) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is 3-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-2-ethylphenyl]propanoic acid.
| Compound Name | 3-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-2-ethylphenyl]propanoic acid |
|---|---|
| PubChem CID | 70409893 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 3-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-2-ethylphenyl]propanoic acid |
| SMILES | CCc1cc(NC(=O)C(C)(C)CCCOc2cc(C)ccc2C)ccc1CCC(=O)O |
| InChI | InChI=1S/C26H35NO4/c1-6-20-17-22(12-10-21(20)11-13-24(28)29)27-25(30)26(4,5)14-7-15-31-23-16-18(2)8-9-19(23)3/h8-10,12,16-17H,6-7,11,13-15H2,1-5H3,(H,27,30)(H,28,29) |
| InChIKey | FUDCEVPVAUBRGV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|