C27H35NO4 — CID 70410052
(2E)-2-[[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-2-methylphenyl]methylidene]butanoic acid (PubChem CID 70410052) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is (2E)-2-[[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-2-methylphenyl]methylidene]butanoic acid.
| Compound Name | (2E)-2-[[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-2-methylphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 70410052 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (2E)-2-[[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-2-methylphenyl]methylidene]butanoic acid |
| SMILES | CC/C(=C\c1ccc(NC(=O)C(C)(C)CCCOc2cc(C)ccc2C)cc1C)C(=O)O |
| InChI | InChI=1S/C27H35NO4/c1-7-21(25(29)30)17-22-11-12-23(16-20(22)4)28-26(31)27(5,6)13-8-14-32-24-15-18(2)9-10-19(24)3/h9-12,15-17H,7-8,13-14H2,1-6H3,(H,28,31)(H,29,30)/b21-17+ |
| InChIKey | YOZJKEQLESEHNZ-HEHNFIMWSA-N |
| XLogP | 6.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|