C37H40N4O6 — CID 101304313
N'-(4-butylbenzoyl)-5-[[3-[[(4-butylbenzoyl)amino]carbamoyl]-4-hydroxyphenyl]methyl]-2-hydroxybenzohydrazide (PubChem CID 101304313) has the molecular formula C37H40N4O6 and a molecular weight of 636.75 g/mol. Its IUPAC name is N'-(4-butylbenzoyl)-5-[[3-[[(4-butylbenzoyl)amino]carbamoyl]-4-hydroxyphenyl]methyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-(4-butylbenzoyl)-5-[[3-[[(4-butylbenzoyl)amino]carbamoyl]-4-hydroxyphenyl]methyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 101304313 |
| Molecular Formula | C37H40N4O6 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | N'-(4-butylbenzoyl)-5-[[3-[[(4-butylbenzoyl)amino]carbamoyl]-4-hydroxyphenyl]methyl]-2-hydroxybenzohydrazide |
| SMILES | CCCCc1ccc(C(=O)NNC(=O)c2cc(Cc3ccc(O)c(C(=O)NNC(=O)c4ccc(CCCC)cc4)c3)ccc2O)cc1 |
| InChI | InChI=1S/C37H40N4O6/c1-3-5-7-24-9-15-28(16-10-24)34(44)38-40-36(46)30-22-26(13-19-32(30)42)21-27-14-20-33(43)31(23-27)37(47)41-39-35(45)29-17-11-25(12-18-29)8-6-4-2/h9-20,22-23,42-43H,3-8,21H2,1-2H3,(H,38,44)(H,39,45)(H,40,46)(H,41,47) |
| InChIKey | RPPQMQQCLJIZEG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|