C27H32 — CID 139753489
1-methyl-4-[(2R)-1-[4-[2-(4-propylphenyl)ethyl]phenyl]propan-2-yl]benzene (PubChem CID 139753489) has the molecular formula C27H32 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1-methyl-4-[(2R)-1-[4-[2-(4-propylphenyl)ethyl]phenyl]propan-2-yl]benzene.
| Compound Name | 1-methyl-4-[(2R)-1-[4-[2-(4-propylphenyl)ethyl]phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 139753489 |
| Molecular Formula | C27H32 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 1-methyl-4-[(2R)-1-[4-[2-(4-propylphenyl)ethyl]phenyl]propan-2-yl]benzene |
| SMILES | CCCc1ccc(CCc2ccc(C[C@@H](C)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H32/c1-4-5-23-8-10-24(11-9-23)12-13-25-14-16-26(17-15-25)20-22(3)27-18-6-21(2)7-19-27/h6-11,14-19,22H,4-5,12-13,20H2,1-3H3/t22-/m1/s1 |
| InChIKey | GCVJQAACPLNXIN-JOCHJYFZSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |