C28H25F3O2 — CID 139874733
2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-[4-(2-methoxyethyl)phenyl]naphthalene (PubChem CID 139874733) has the molecular formula C28H25F3O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-[4-(2-methoxyethyl)phenyl]naphthalene.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-[4-(2-methoxyethyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 139874733 |
| Molecular Formula | C28H25F3O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-fluoro-6-[4-(2-methoxyethyl)phenyl]naphthalene |
| SMILES | COCCc1ccc(-c2ccc3c(F)c(CCc4ccc(OC(F)F)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H25F3O2/c1-32-17-16-20-2-7-21(8-3-20)23-12-15-26-24(18-23)11-10-22(27(26)29)9-4-19-5-13-25(14-6-19)33-28(30)31/h2-3,5-8,10-15,18,28H,4,9,16-17H2,1H3 |
| InChIKey | VEDICGXZTMTBRN-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |