C28H23F5 — CID 139873971
1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-6-(4-propylphenyl)naphthalene (PubChem CID 139873971) has the molecular formula C28H23F5 and a molecular weight of 454.48 g/mol. Its IUPAC name is 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-6-(4-propylphenyl)naphthalene.
| Compound Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-6-(4-propylphenyl)naphthalene |
|---|---|
| PubChem CID | 139873971 |
| Molecular Formula | C28H23F5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-6-(4-propylphenyl)naphthalene |
| SMILES | CCCc1ccc(-c2ccc3c(F)c(CCc4ccc(C(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H23F5/c1-2-3-18-4-8-20(9-5-18)22-13-14-24-23(17-22)12-11-21(27(24)30)10-6-19-7-15-25(26(29)16-19)28(31,32)33/h4-5,7-9,11-17H,2-3,6,10H2,1H3 |
| InChIKey | MPKQWCKUJWFRNY-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |