C28H24F5NO — CID 139872384
5-butoxy-2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]pyridine (PubChem CID 139872384) has the molecular formula C28H24F5NO and a molecular weight of 485.50 g/mol. Its IUPAC name is 5-butoxy-2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]pyridine.
| Compound Name | 5-butoxy-2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]pyridine |
|---|---|
| PubChem CID | 139872384 |
| Molecular Formula | C28H24F5NO |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 5-butoxy-2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]pyridine |
| SMILES | CCCCOc1ccc(-c2ccc3c(F)c(CCc4ccc(C(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C28H24F5NO/c1-2-3-14-35-22-10-13-26(34-17-22)21-9-11-23-20(16-21)8-7-19(27(23)30)6-4-18-5-12-24(25(29)15-18)28(31,32)33/h5,7-13,15-17H,2-4,6,14H2,1H3 |
| InChIKey | JCHXMEVALMBEKZ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|