C27H24ClF2NO — CID 139872748
2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-(3-methoxypropyl)pyridine (PubChem CID 139872748) has the molecular formula C27H24ClF2NO and a molecular weight of 451.94 g/mol. Its IUPAC name is 2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-(3-methoxypropyl)pyridine.
| Compound Name | 2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-(3-methoxypropyl)pyridine |
|---|---|
| PubChem CID | 139872748 |
| Molecular Formula | C27H24ClF2NO |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-(3-methoxypropyl)pyridine |
| SMILES | COCCCc1ccc(-c2ccc3c(F)c(CCc4ccc(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C27H24ClF2NO/c1-32-14-2-3-19-6-13-26(31-17-19)22-10-11-23-21(16-22)9-8-20(27(23)30)7-4-18-5-12-24(28)25(29)15-18/h5-6,8-13,15-17H,2-4,7,14H2,1H3 |
| InChIKey | QZDZNPHQIICYLE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|