C28H24F2N2O — CID 139874304
2-fluoro-4-[2-[1-fluoro-6-[5-(3-methoxypropyl)-2-pyridinyl]naphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139874304) has the molecular formula C28H24F2N2O and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-fluoro-4-[2-[1-fluoro-6-[5-(3-methoxypropyl)-2-pyridinyl]naphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 2-fluoro-4-[2-[1-fluoro-6-[5-(3-methoxypropyl)-2-pyridinyl]naphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139874304 |
| Molecular Formula | C28H24F2N2O |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-fluoro-4-[2-[1-fluoro-6-[5-(3-methoxypropyl)-2-pyridinyl]naphthalen-2-yl]ethyl]benzonitrile |
| SMILES | COCCCc1ccc(-c2ccc3c(F)c(CCc4ccc(C#N)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C28H24F2N2O/c1-33-14-2-3-20-6-13-27(32-18-20)23-11-12-25-22(16-23)10-9-21(28(25)30)7-4-19-5-8-24(17-31)26(29)15-19/h5-6,8-13,15-16,18H,2-4,7,14H2,1H3 |
| InChIKey | YVWPVXLLATXMEI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|