C29H28FN3O — CID 139874349
4-[2-[1-fluoro-6-[2-[5-(3-methoxypropyl)pyrimidin-2-yl]ethyl]naphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139874349) has the molecular formula C29H28FN3O and a molecular weight of 453.56 g/mol. Its IUPAC name is 4-[2-[1-fluoro-6-[2-[5-(3-methoxypropyl)pyrimidin-2-yl]ethyl]naphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 4-[2-[1-fluoro-6-[2-[5-(3-methoxypropyl)pyrimidin-2-yl]ethyl]naphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139874349 |
| Molecular Formula | C29H28FN3O |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 4-[2-[1-fluoro-6-[2-[5-(3-methoxypropyl)pyrimidin-2-yl]ethyl]naphthalen-2-yl]ethyl]benzonitrile |
| SMILES | COCCCc1cnc(CCc2ccc3c(F)c(CCc4ccc(C#N)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C29H28FN3O/c1-34-16-2-3-24-19-32-28(33-20-24)15-10-22-9-14-27-26(17-22)13-12-25(29(27)30)11-8-21-4-6-23(18-31)7-5-21/h4-7,9,12-14,17,19-20H,2-3,8,10-11,15-16H2,1H3 |
| InChIKey | JMYKAZPHPFTEPF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|