C29H26F2N2 — CID 139873527
2-fluoro-4-[2-[1-fluoro-6-(5-pentyl-2-pyridinyl)naphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139873527) has the molecular formula C29H26F2N2 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-fluoro-4-[2-[1-fluoro-6-(5-pentyl-2-pyridinyl)naphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 2-fluoro-4-[2-[1-fluoro-6-(5-pentyl-2-pyridinyl)naphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139873527 |
| Molecular Formula | C29H26F2N2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-fluoro-4-[2-[1-fluoro-6-(5-pentyl-2-pyridinyl)naphthalen-2-yl]ethyl]benzonitrile |
| SMILES | CCCCCc1ccc(-c2ccc3c(F)c(CCc4ccc(C#N)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C29H26F2N2/c1-2-3-4-5-21-8-15-28(33-19-21)24-13-14-26-23(17-24)12-11-22(29(26)31)9-6-20-7-10-25(18-32)27(30)16-20/h7-8,10-17,19H,2-6,9H2,1H3 |
| InChIKey | PFUYHFNXHDVVDZ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|