C28H22F6O — CID 139875545
6-[2,6-difluoro-4-(3-methoxypropyl)phenyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene (PubChem CID 139875545) has the molecular formula C28H22F6O and a molecular weight of 488.47 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(3-methoxypropyl)phenyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene.
| Compound Name | 6-[2,6-difluoro-4-(3-methoxypropyl)phenyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 139875545 |
| Molecular Formula | C28H22F6O |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 6-[2,6-difluoro-4-(3-methoxypropyl)phenyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethyl]naphthalene |
| SMILES | COCCCc1cc(F)c(-c2ccc3c(F)c(CCc4cc(F)c(F)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C28H22F6O/c1-35-10-2-3-16-11-22(29)26(23(30)12-16)20-8-9-21-19(15-20)7-6-18(27(21)33)5-4-17-13-24(31)28(34)25(32)14-17/h6-9,11-15H,2-5,10H2,1H3 |
| InChIKey | NLKQCJIOTZZCFV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|