C19H18N2 — CID 139780621
4-[[4-[(E)-pent-3-enyl]phenyl]methylideneamino]benzonitrile (PubChem CID 139780621) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-[[4-[(E)-pent-3-enyl]phenyl]methylideneamino]benzonitrile.
| Compound Name | 4-[[4-[(E)-pent-3-enyl]phenyl]methylideneamino]benzonitrile |
|---|---|
| PubChem CID | 139780621 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 4-[[4-[(E)-pent-3-enyl]phenyl]methylideneamino]benzonitrile |
| SMILES | C/C=C/CCc1ccc(/C=N/c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H18N2/c1-2-3-4-5-16-6-8-18(9-7-16)15-21-19-12-10-17(14-20)11-13-19/h2-3,6-13,15H,4-5H2,1H3/b3-2+,21-15+ |
| InChIKey | VBQJUJWZFIXEQF-YGOYCJOLSA-N |
| XLogP | 4.82 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|