C41H48N2O2 — CID 102120024
4-[4-[9-[4-[(4-hexylphenyl)iminomethyl]phenoxy]nonoxy]phenyl]benzonitrile (PubChem CID 102120024) has the molecular formula C41H48N2O2 and a molecular weight of 600.85 g/mol. Its IUPAC name is 4-[4-[9-[4-[(4-hexylphenyl)iminomethyl]phenoxy]nonoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[9-[4-[(4-hexylphenyl)iminomethyl]phenoxy]nonoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 102120024 |
| Molecular Formula | C41H48N2O2 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.37 |
| IUPAC Name | 4-[4-[9-[4-[(4-hexylphenyl)iminomethyl]phenoxy]nonoxy]phenyl]benzonitrile |
| SMILES | CCCCCCc1ccc(/N=C/c2ccc(OCCCCCCCCCOc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H48N2O2/c1-2-3-4-10-13-34-16-24-39(25-17-34)43-33-36-18-26-40(27-19-36)44-30-11-8-6-5-7-9-12-31-45-41-28-22-38(23-29-41)37-20-14-35(32-42)15-21-37/h14-29,33H,2-13,30-31H2,1H3/b43-33+ |
| InChIKey | SCLIQRHKAUYSCS-FXLOMAGBSA-N |
| XLogP | 11.29 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|