C35H36N2O2 — CID 169302425
4-[4-[4-[4-[[4-[(2R)-2-methylbutyl]phenyl]iminomethyl]phenoxy]butoxy]phenyl]benzonitrile (PubChem CID 169302425) has the molecular formula C35H36N2O2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 4-[4-[4-[4-[[4-[(2R)-2-methylbutyl]phenyl]iminomethyl]phenoxy]butoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[4-[4-[[4-[(2R)-2-methylbutyl]phenyl]iminomethyl]phenoxy]butoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 169302425 |
| Molecular Formula | C35H36N2O2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 4-[4-[4-[4-[[4-[(2R)-2-methylbutyl]phenyl]iminomethyl]phenoxy]butoxy]phenyl]benzonitrile |
| SMILES | CC[C@@H](C)Cc1ccc(/N=C/c2ccc(OCCCCOc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H36N2O2/c1-3-27(2)24-28-8-16-33(17-9-28)37-26-30-10-18-34(19-11-30)38-22-4-5-23-39-35-20-14-32(15-21-35)31-12-6-29(25-36)7-13-31/h6-21,26-27H,3-5,22-24H2,1-2H3/b37-26+/t27-/m1/s1 |
| InChIKey | OOFVOGNQOHOQEI-SNDSILTISA-N |
| XLogP | 8.80 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|