C27H26N2O2 — CID 4623457
[4-[(4-cyanophenyl)iminomethyl]phenyl] 4-hexylbenzoate (PubChem CID 4623457) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is [4-[(4-cyanophenyl)iminomethyl]phenyl] 4-hexylbenzoate.
| Compound Name | [4-[(4-cyanophenyl)iminomethyl]phenyl] 4-hexylbenzoate |
|---|---|
| PubChem CID | 4623457 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [4-[(4-cyanophenyl)iminomethyl]phenyl] 4-hexylbenzoate |
| SMILES | CCCCCCc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O2/c1-2-3-4-5-6-21-7-13-24(14-8-21)27(30)31-26-17-11-23(12-18-26)20-29-25-15-9-22(19-28)10-16-25/h7-18,20H,2-6H2,1H3/b29-20+ |
| InChIKey | QKRDANAXNZXDBU-ZTKZIYFRSA-N |
| XLogP | 6.65 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|