C28H19F5O — CID 139850801
1-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-6-[2-(4-propylphenyl)ethynyl]naphthalene (PubChem CID 139850801) has the molecular formula C28H19F5O and a molecular weight of 466.45 g/mol. Its IUPAC name is 1-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-6-[2-(4-propylphenyl)ethynyl]naphthalene.
| Compound Name | 1-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-6-[2-(4-propylphenyl)ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850801 |
| Molecular Formula | C28H19F5O |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-6-[2-(4-propylphenyl)ethynyl]naphthalene |
| SMILES | CCCc1ccc(C#Cc2ccc3c(F)c(-c4ccc(OC(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H19F5O/c1-2-3-18-4-6-19(7-5-18)8-9-20-10-13-23-21(16-20)11-14-24(27(23)30)22-12-15-26(25(29)17-22)34-28(31,32)33/h4-7,10-17H,2-3H2,1H3 |
| InChIKey | MTBZOXYDZZVGHW-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|