C18H11F5O — CID 23565854
1-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-6-methylnaphthalene (PubChem CID 23565854) has the molecular formula C18H11F5O and a molecular weight of 338.28 g/mol. Its IUPAC name is 1-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-6-methylnaphthalene.
| Compound Name | 1-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-6-methylnaphthalene |
|---|---|
| PubChem CID | 23565854 |
| Molecular Formula | C18H11F5O |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-6-methylnaphthalene |
| SMILES | Cc1ccc2c(F)c(-c3ccc(OC(F)(F)F)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C18H11F5O/c1-10-2-5-13-11(8-10)3-6-14(17(13)20)12-4-7-16(15(19)9-12)24-18(21,22)23/h2-9H,1H3 |
| InChIKey | RDLPHVYTTXHMEL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |