C37H38F6O2 — CID 144502444
5-[7-[3,5-dimethyl-4-[4-(trifluoromethoxy)phenyl]phenyl]heptyl]-1,3-dimethyl-2-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 144502444) has the molecular formula C37H38F6O2 and a molecular weight of 628.70 g/mol. Its IUPAC name is 5-[7-[3,5-dimethyl-4-[4-(trifluoromethoxy)phenyl]phenyl]heptyl]-1,3-dimethyl-2-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 5-[7-[3,5-dimethyl-4-[4-(trifluoromethoxy)phenyl]phenyl]heptyl]-1,3-dimethyl-2-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 144502444 |
| Molecular Formula | C37H38F6O2 |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | 5-[7-[3,5-dimethyl-4-[4-(trifluoromethoxy)phenyl]phenyl]heptyl]-1,3-dimethyl-2-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | Cc1cc(CCCCCCCc2cc(C)c(-c3ccc(OC(F)(F)F)cc3)c(C)c2)cc(C)c1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C37H38F6O2/c1-24-20-28(21-25(2)34(24)30-12-16-32(17-13-30)44-36(38,39)40)10-8-6-5-7-9-11-29-22-26(3)35(27(4)23-29)31-14-18-33(19-15-31)45-37(41,42)43/h12-23H,5-11H2,1-4H3 |
| InChIKey | IBNDXZSWHQEURU-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|