C34H48O4Si2 — CID 19972164
4-[5-[dimethyl(trimethylsilyloxy)silyl]pentoxy]-2-[4-(4-pentylphenyl)phenyl]benzoic acid (PubChem CID 19972164) has the molecular formula C34H48O4Si2 and a molecular weight of 576.93 g/mol. Its IUPAC name is 4-[5-[dimethyl(trimethylsilyloxy)silyl]pentoxy]-2-[4-(4-pentylphenyl)phenyl]benzoic acid.
| Compound Name | 4-[5-[dimethyl(trimethylsilyloxy)silyl]pentoxy]-2-[4-(4-pentylphenyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 19972164 |
| Molecular Formula | C34H48O4Si2 |
| Molecular Weight | 576.93 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 4-[5-[dimethyl(trimethylsilyloxy)silyl]pentoxy]-2-[4-(4-pentylphenyl)phenyl]benzoic acid |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(OCCCCC[Si](C)(C)O[Si](C)(C)C)ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H48O4Si2/c1-7-8-10-13-27-14-16-28(17-15-27)29-18-20-30(21-19-29)33-26-31(22-23-32(33)34(35)36)37-24-11-9-12-25-40(5,6)38-39(2,3)4/h14-23,26H,7-13,24-25H2,1-6H3,(H,35,36) |
| InChIKey | UBKSGLAFDADWCO-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.93 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|