C27H29NO4Si — CID 54066220
2-[4-(4-cyanophenyl)phenyl]-4-[3-[ethoxy(dimethyl)silyl]propoxy]benzoic acid (PubChem CID 54066220) has the molecular formula C27H29NO4Si and a molecular weight of 459.62 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)phenyl]-4-[3-[ethoxy(dimethyl)silyl]propoxy]benzoic acid.
| Compound Name | 2-[4-(4-cyanophenyl)phenyl]-4-[3-[ethoxy(dimethyl)silyl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 54066220 |
| Molecular Formula | C27H29NO4Si |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-[4-(4-cyanophenyl)phenyl]-4-[3-[ethoxy(dimethyl)silyl]propoxy]benzoic acid |
| SMILES | CCO[Si](C)(C)CCCOc1ccc(C(=O)O)c(-c2ccc(-c3ccc(C#N)cc3)cc2)c1 |
| InChI | InChI=1S/C27H29NO4Si/c1-4-32-33(2,3)17-5-16-31-24-14-15-25(27(29)30)26(18-24)23-12-10-22(11-13-23)21-8-6-20(19-28)7-9-21/h6-15,18H,4-5,16-17H2,1-3H3,(H,29,30) |
| InChIKey | MDEKKWGSLANVDO-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|