C42H63NO6Si2 — CID 68583662
4-[4-[(2S)-6-[dimethyl(trimethylsilyloxy)silyl]hexan-2-yl]oxy-3-nitrododecyl]-2-(4-phenylphenyl)benzoic acid (PubChem CID 68583662) has the molecular formula C42H63NO6Si2 and a molecular weight of 734.14 g/mol. Its IUPAC name is 4-[4-[(2S)-6-[dimethyl(trimethylsilyloxy)silyl]hexan-2-yl]oxy-3-nitrododecyl]-2-(4-phenylphenyl)benzoic acid.
| Compound Name | 4-[4-[(2S)-6-[dimethyl(trimethylsilyloxy)silyl]hexan-2-yl]oxy-3-nitrododecyl]-2-(4-phenylphenyl)benzoic acid |
|---|---|
| PubChem CID | 68583662 |
| Molecular Formula | C42H63NO6Si2 |
| Molecular Weight | 734.14 g/mol |
| Exact Mass | 733.42 |
| IUPAC Name | 4-[4-[(2S)-6-[dimethyl(trimethylsilyloxy)silyl]hexan-2-yl]oxy-3-nitrododecyl]-2-(4-phenylphenyl)benzoic acid |
| SMILES | CCCCCCCCC(O[C@@H](C)CCCC[Si](C)(C)O[Si](C)(C)C)C(CCc1ccc(C(=O)O)c(-c2ccc(-c3ccccc3)cc2)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C42H63NO6Si2/c1-8-9-10-11-12-16-22-41(48-33(2)19-17-18-31-51(6,7)49-50(3,4)5)40(43(46)47)30-24-34-23-29-38(42(44)45)39(32-34)37-27-25-36(26-28-37)35-20-14-13-15-21-35/h13-15,20-21,23,25-29,32-33,40-41H,8-12,16-19,22,24,30-31H2,1-7H3,(H,44,45)/t33-,40?,41?/m0/s1 |
| InChIKey | STZKKMCZIYIFGY-UUBKBLJDSA-N |
| XLogP | 12.05 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.14 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|