C39H59NO8Si3 — CID 101024286
[4-(4-heptan-2-yloxy-3-nitrophenyl)phenyl] 4-[6-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]hexoxy]benzoate (PubChem CID 101024286) has the molecular formula C39H59NO8Si3 and a molecular weight of 754.16 g/mol. Its IUPAC name is [4-(4-heptan-2-yloxy-3-nitrophenyl)phenyl] 4-[6-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]hexoxy]benzoate.
| Compound Name | [4-(4-heptan-2-yloxy-3-nitrophenyl)phenyl] 4-[6-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]hexoxy]benzoate |
|---|---|
| PubChem CID | 101024286 |
| Molecular Formula | C39H59NO8Si3 |
| Molecular Weight | 754.16 g/mol |
| Exact Mass | 753.35 |
| IUPAC Name | [4-(4-heptan-2-yloxy-3-nitrophenyl)phenyl] 4-[6-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]hexoxy]benzoate |
| SMILES | CCCCCC(C)Oc1ccc(-c2ccc(OC(=O)c3ccc(OCCCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)cc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C39H59NO8Si3/c1-10-11-14-17-31(2)45-38-27-22-34(30-37(38)40(42)43)32-18-25-36(26-19-32)46-39(41)33-20-23-35(24-21-33)44-28-15-12-13-16-29-50(6,7)48-51(8,9)47-49(3,4)5/h18-27,30-31H,10-17,28-29H2,1-9H3 |
| InChIKey | LOMHGIHFQLRTLB-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.16 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|