C21H25NO5 — CID 54374222
[3-nitro-4-[(2S)-octan-2-yl]oxyphenyl] benzoate (PubChem CID 54374222) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [3-nitro-4-[(2S)-octan-2-yl]oxyphenyl] benzoate.
| Compound Name | [3-nitro-4-[(2S)-octan-2-yl]oxyphenyl] benzoate |
|---|---|
| PubChem CID | 54374222 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [3-nitro-4-[(2S)-octan-2-yl]oxyphenyl] benzoate |
| SMILES | CCCCCC[C@H](C)Oc1ccc(OC(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25NO5/c1-3-4-5-7-10-16(2)26-20-14-13-18(15-19(20)22(24)25)27-21(23)17-11-8-6-9-12-17/h6,8-9,11-16H,3-5,7,10H2,1-2H3/t16-/m0/s1 |
| InChIKey | UVIPMTWEVYNBDO-INIZCTEOSA-N |
| XLogP | 5.55 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|