C40H54N2O5 — CID 67681349
[4-[2-(4-pentylcyclohexyl)ethyl]phenyl] 4-[2-amino-5-nitro-4-[(2R)-octan-2-yl]oxyphenyl]benzoate (PubChem CID 67681349) has the molecular formula C40H54N2O5 and a molecular weight of 642.88 g/mol. Its IUPAC name is [4-[2-(4-pentylcyclohexyl)ethyl]phenyl] 4-[2-amino-5-nitro-4-[(2R)-octan-2-yl]oxyphenyl]benzoate.
| Compound Name | [4-[2-(4-pentylcyclohexyl)ethyl]phenyl] 4-[2-amino-5-nitro-4-[(2R)-octan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 67681349 |
| Molecular Formula | C40H54N2O5 |
| Molecular Weight | 642.88 g/mol |
| Exact Mass | 642.40 |
| IUPAC Name | [4-[2-(4-pentylcyclohexyl)ethyl]phenyl] 4-[2-amino-5-nitro-4-[(2R)-octan-2-yl]oxyphenyl]benzoate |
| SMILES | CCCCCC[C@@H](C)Oc1cc(N)c(-c2ccc(C(=O)Oc3ccc(CCC4CCC(CCCCC)CC4)cc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C40H54N2O5/c1-4-6-8-10-11-29(3)46-39-28-37(41)36(27-38(39)42(44)45)33-21-23-34(24-22-33)40(43)47-35-25-19-32(20-26-35)18-17-31-15-13-30(14-16-31)12-9-7-5-2/h19-31H,4-18,41H2,1-3H3/t29-,30?,31?/m1/s1 |
| InChIKey | HHJSMNNYJNTTEL-QCKVGYCISA-N |
| XLogP | 11.12 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.88 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|