C37H49NO6 — CID 102533198
[4-(2-nitro-4-octan-2-yloxyphenyl)phenyl] 4-decoxybenzoate (PubChem CID 102533198) has the molecular formula C37H49NO6 and a molecular weight of 603.80 g/mol. Its IUPAC name is [4-(2-nitro-4-octan-2-yloxyphenyl)phenyl] 4-decoxybenzoate.
| Compound Name | [4-(2-nitro-4-octan-2-yloxyphenyl)phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 102533198 |
| Molecular Formula | C37H49NO6 |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 603.36 |
| IUPAC Name | [4-(2-nitro-4-octan-2-yloxyphenyl)phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(C)CCCCCC)cc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C37H49NO6/c1-4-6-8-10-11-12-13-15-27-42-32-21-19-31(20-22-32)37(39)44-33-23-17-30(18-24-33)35-26-25-34(28-36(35)38(40)41)43-29(3)16-14-9-7-5-2/h17-26,28-29H,4-16,27H2,1-3H3 |
| InChIKey | NKOXAUWRCGELQM-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|