C61H68N2O17 — CID 54518716
2-O-[3-[4-[2-amino-5-nitro-4-[(2S)-octan-2-yl]oxyphenyl]benzoyl]oxypropyl] 1-O,4-O-bis[4-(5-prop-2-enoyloxypentoxy)phenyl] benzene-1,2,4-tricarboxylate (PubChem CID 54518716) has the molecular formula C61H68N2O17 and a molecular weight of 1101.21 g/mol. Its IUPAC name is 2-O-[3-[4-[2-amino-5-nitro-4-[(2S)-octan-2-yl]oxyphenyl]benzoyl]oxypropyl] 1-O,4-O-bis[4-(5-prop-2-enoyloxypentoxy)phenyl] benzene-1,2,4-tricarboxylate.
| Compound Name | 2-O-[3-[4-[2-amino-5-nitro-4-[(2S)-octan-2-yl]oxyphenyl]benzoyl]oxypropyl] 1-O,4-O-bis[4-(5-prop-2-enoyloxypentoxy)phenyl] benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 54518716 |
| Molecular Formula | C61H68N2O17 |
| Molecular Weight | 1101.21 g/mol |
| Exact Mass | 1100.45 |
| IUPAC Name | 2-O-[3-[4-[2-amino-5-nitro-4-[(2S)-octan-2-yl]oxyphenyl]benzoyl]oxypropyl] 1-O,4-O-bis[4-(5-prop-2-enoyloxypentoxy)phenyl] benzene-1,2,4-tricarboxylate |
| SMILES | C=CC(=O)OCCCCCOc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(OCCCCCOC(=O)C=C)cc3)c(C(=O)OCCCOC(=O)c3ccc(-c4cc([N+](=O)[O-])c(O[C@@H](C)CCCCCC)cc4N)cc3)c2)cc1 |
| InChI | InChI=1S/C61H68N2O17/c1-5-8-9-12-18-42(4)78-55-41-53(62)51(40-54(55)63(70)71)43-19-21-44(22-20-43)58(66)76-37-17-38-77-60(68)52-39-45(59(67)79-48-28-24-46(25-29-48)72-33-13-10-15-35-74-56(64)6-2)23-32-50(52)61(69)80-49-30-26-47(27-31-49)73-34-14-11-16-36-75-57(65)7-3/h6-7,19-32,39-42H,2-3,5,8-18,33-38,62H2,1,4H3/t42-/m0/s1 |
| InChIKey | YOFZFUMXYTYHOQ-WBCKFURZSA-N |
| XLogP | 11.98 |
| TPSA | 254.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.21 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|