C49H58N2O14 — CID 19033497
2-[[4-(2-amino-5-nitro-4-octoxybenzoyl)oxyphenyl]methoxycarbonyl]terephthalic acid;9-phenoxynonyl prop-2-enoate (PubChem CID 19033497) has the molecular formula C49H58N2O14 and a molecular weight of 899.00 g/mol. Its IUPAC name is 2-[[4-(2-amino-5-nitro-4-octoxybenzoyl)oxyphenyl]methoxycarbonyl]terephthalic acid;9-phenoxynonyl prop-2-enoate.
| Compound Name | 2-[[4-(2-amino-5-nitro-4-octoxybenzoyl)oxyphenyl]methoxycarbonyl]terephthalic acid;9-phenoxynonyl prop-2-enoate |
|---|---|
| PubChem CID | 19033497 |
| Molecular Formula | C49H58N2O14 |
| Molecular Weight | 899.00 g/mol |
| Exact Mass | 898.39 |
| IUPAC Name | 2-[[4-(2-amino-5-nitro-4-octoxybenzoyl)oxyphenyl]methoxycarbonyl]terephthalic acid;9-phenoxynonyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCOc1ccccc1.CCCCCCCCOc1cc(N)c(C(=O)Oc2ccc(COC(=O)c3cc(C(=O)O)ccc3C(=O)O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H32N2O11.C18H26O3/c1-2-3-4-5-6-7-14-42-27-17-25(32)24(16-26(27)33(40)41)31(39)44-21-11-8-19(9-12-21)18-43-30(38)23-15-20(28(34)35)10-13-22(23)29(36)37;1-2-18(19)21-16-12-7-5-3-4-6-11-15-20-17-13-9-8-10-14-17/h8-13,15-17H,2-7,14,18,32H2,1H3,(H,34,35)(H,36,37);2,8-10,13-14H,1,3-7,11-12,15-16H2 |
| InChIKey | GJXOHTXLGPIOJN-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 241.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.00 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|