C32H43NO7Si2 — CID 59271004
[4-(4-heptan-2-yloxy-3-nitrophenyl)phenyl] 4-[[dimethyl(trimethylsilyloxy)silyl]methoxy]benzoate (PubChem CID 59271004) has the molecular formula C32H43NO7Si2 and a molecular weight of 609.87 g/mol. Its IUPAC name is [4-(4-heptan-2-yloxy-3-nitrophenyl)phenyl] 4-[[dimethyl(trimethylsilyloxy)silyl]methoxy]benzoate.
| Compound Name | [4-(4-heptan-2-yloxy-3-nitrophenyl)phenyl] 4-[[dimethyl(trimethylsilyloxy)silyl]methoxy]benzoate |
|---|---|
| PubChem CID | 59271004 |
| Molecular Formula | C32H43NO7Si2 |
| Molecular Weight | 609.87 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | [4-(4-heptan-2-yloxy-3-nitrophenyl)phenyl] 4-[[dimethyl(trimethylsilyloxy)silyl]methoxy]benzoate |
| SMILES | CCCCCC(C)Oc1ccc(-c2ccc(OC(=O)c3ccc(OC[Si](C)(C)O[Si](C)(C)C)cc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H43NO7Si2/c1-8-9-10-11-24(2)38-31-21-16-27(22-30(31)33(35)36)25-12-19-29(20-13-25)39-32(34)26-14-17-28(18-15-26)37-23-42(6,7)40-41(3,4)5/h12-22,24H,8-11,23H2,1-7H3 |
| InChIKey | BDZURWQAQOTBAZ-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.87 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|