C42H49NO10 — CID 102148966
[4-[4-(3,4-dibutoxybenzoyl)oxy-3-nitrophenyl]phenyl] 3,4-dibutoxybenzoate (PubChem CID 102148966) has the molecular formula C42H49NO10 and a molecular weight of 727.85 g/mol. Its IUPAC name is [4-[4-(3,4-dibutoxybenzoyl)oxy-3-nitrophenyl]phenyl] 3,4-dibutoxybenzoate.
| Compound Name | [4-[4-(3,4-dibutoxybenzoyl)oxy-3-nitrophenyl]phenyl] 3,4-dibutoxybenzoate |
|---|---|
| PubChem CID | 102148966 |
| Molecular Formula | C42H49NO10 |
| Molecular Weight | 727.85 g/mol |
| Exact Mass | 727.34 |
| IUPAC Name | [4-[4-(3,4-dibutoxybenzoyl)oxy-3-nitrophenyl]phenyl] 3,4-dibutoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(=O)c4ccc(OCCCC)c(OCCCC)c4)c([N+](=O)[O-])c3)cc2)cc1OCCCC |
| InChI | InChI=1S/C42H49NO10/c1-5-9-23-48-37-21-16-32(28-39(37)50-25-11-7-3)41(44)52-34-18-13-30(14-19-34)31-15-20-36(35(27-31)43(46)47)53-42(45)33-17-22-38(49-24-10-6-2)40(29-33)51-26-12-8-4/h13-22,27-29H,5-12,23-26H2,1-4H3 |
| InChIKey | CIZCTOHMEUYJAB-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.85 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|