C27H29NO5 — CID 58240518
[4-[4-(2-methylhexan-2-yloxy)-3-nitrophenyl]phenyl] 4-methylbenzoate (PubChem CID 58240518) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is [4-[4-(2-methylhexan-2-yloxy)-3-nitrophenyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[4-(2-methylhexan-2-yloxy)-3-nitrophenyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 58240518 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [4-[4-(2-methylhexan-2-yloxy)-3-nitrophenyl]phenyl] 4-methylbenzoate |
| SMILES | CCCCC(C)(C)Oc1ccc(-c2ccc(OC(=O)c3ccc(C)cc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H29NO5/c1-5-6-17-27(3,4)33-25-16-13-22(18-24(25)28(30)31)20-11-14-23(15-12-20)32-26(29)21-9-7-19(2)8-10-21/h7-16,18H,5-6,17H2,1-4H3 |
| InChIKey | JPSMVNSZMWGKEB-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|