C35H41NO8 — CID 19809902
[4-(4-hexoxyphenyl)-2-nitrophenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate (PubChem CID 19809902) has the molecular formula C35H41NO8 and a molecular weight of 603.71 g/mol. Its IUPAC name is [4-(4-hexoxyphenyl)-2-nitrophenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate.
| Compound Name | [4-(4-hexoxyphenyl)-2-nitrophenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 19809902 |
| Molecular Formula | C35H41NO8 |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | [4-(4-hexoxyphenyl)-2-nitrophenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCCCCCC)cc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H41NO8/c1-4-5-6-9-22-41-30-17-12-27(13-18-30)29-16-21-33(32(25-29)36(39)40)44-35(38)28-14-19-31(20-15-28)42-23-10-7-8-11-24-43-34(37)26(2)3/h12-21,25H,2,4-11,22-24H2,1,3H3 |
| InChIKey | TWNDVILRQVDIDE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|