C30H31NO8 — CID 54314434
9-[4-[4-(4-methoxyphenyl)-2-nitrophenoxy]carbonylphenoxy]-2-methylidenenonanoic acid (PubChem CID 54314434) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is 9-[4-[4-(4-methoxyphenyl)-2-nitrophenoxy]carbonylphenoxy]-2-methylidenenonanoic acid.
| Compound Name | 9-[4-[4-(4-methoxyphenyl)-2-nitrophenoxy]carbonylphenoxy]-2-methylidenenonanoic acid |
|---|---|
| PubChem CID | 54314434 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 9-[4-[4-(4-methoxyphenyl)-2-nitrophenoxy]carbonylphenoxy]-2-methylidenenonanoic acid |
| SMILES | C=C(CCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC)cc3)cc2[N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C30H31NO8/c1-21(29(32)33)8-6-4-3-5-7-19-38-26-16-11-23(12-17-26)30(34)39-28-18-13-24(20-27(28)31(35)36)22-9-14-25(37-2)15-10-22/h9-18,20H,1,3-8,19H2,2H3,(H,32,33) |
| InChIKey | SNDSJBQXMDLRJY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|