C34H39NO8 — CID 54400125
12-[4-[4-(4-ethoxyphenyl)-2-nitrophenoxy]carbonylphenoxy]-2-methylidenedodecanoic acid (PubChem CID 54400125) has the molecular formula C34H39NO8 and a molecular weight of 589.69 g/mol. Its IUPAC name is 12-[4-[4-(4-ethoxyphenyl)-2-nitrophenoxy]carbonylphenoxy]-2-methylidenedodecanoic acid.
| Compound Name | 12-[4-[4-(4-ethoxyphenyl)-2-nitrophenoxy]carbonylphenoxy]-2-methylidenedodecanoic acid |
|---|---|
| PubChem CID | 54400125 |
| Molecular Formula | C34H39NO8 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 12-[4-[4-(4-ethoxyphenyl)-2-nitrophenoxy]carbonylphenoxy]-2-methylidenedodecanoic acid |
| SMILES | C=C(CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCC)cc3)cc2[N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C34H39NO8/c1-3-41-29-18-13-26(14-19-29)28-17-22-32(31(24-28)35(39)40)43-34(38)27-15-20-30(21-16-27)42-23-11-9-7-5-4-6-8-10-12-25(2)33(36)37/h13-22,24H,2-12,23H2,1H3,(H,36,37) |
| InChIKey | VMUYZCMHQNSIJX-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|