C40H38N2O12 — CID 102169454
[8-(4-hexoxybenzoyl)oxy-4,5-dinitro-9,10-dioxoanthracen-1-yl] 4-hexoxybenzoate (PubChem CID 102169454) has the molecular formula C40H38N2O12 and a molecular weight of 738.75 g/mol. Its IUPAC name is [8-(4-hexoxybenzoyl)oxy-4,5-dinitro-9,10-dioxoanthracen-1-yl] 4-hexoxybenzoate.
| Compound Name | [8-(4-hexoxybenzoyl)oxy-4,5-dinitro-9,10-dioxoanthracen-1-yl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 102169454 |
| Molecular Formula | C40H38N2O12 |
| Molecular Weight | 738.75 g/mol |
| Exact Mass | 738.24 |
| IUPAC Name | [8-(4-hexoxybenzoyl)oxy-4,5-dinitro-9,10-dioxoanthracen-1-yl] 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc([N+](=O)[O-])c3c2C(=O)c2c(OC(=O)c4ccc(OCCCCCC)cc4)ccc([N+](=O)[O-])c2C3=O)cc1 |
| InChI | InChI=1S/C40H38N2O12/c1-3-5-7-9-23-51-27-15-11-25(12-16-27)39(45)53-31-21-19-29(41(47)48)33-35(31)38(44)36-32(22-20-30(42(49)50)34(36)37(33)43)54-40(46)26-13-17-28(18-14-26)52-24-10-8-6-4-2/h11-22H,3-10,23-24H2,1-2H3 |
| InChIKey | NNYRNBQSHKEBBF-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 191.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.75 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|