C30H31NO8 — CID 19809949
[4-(4-ethoxyphenyl)-2-nitrophenyl] 4-[5-(2-methylprop-2-enoyloxy)pentoxy]benzoate (PubChem CID 19809949) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is [4-(4-ethoxyphenyl)-2-nitrophenyl] 4-[5-(2-methylprop-2-enoyloxy)pentoxy]benzoate.
| Compound Name | [4-(4-ethoxyphenyl)-2-nitrophenyl] 4-[5-(2-methylprop-2-enoyloxy)pentoxy]benzoate |
|---|---|
| PubChem CID | 19809949 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | [4-(4-ethoxyphenyl)-2-nitrophenyl] 4-[5-(2-methylprop-2-enoyloxy)pentoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCC)cc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H31NO8/c1-4-36-25-13-8-22(9-14-25)24-12-17-28(27(20-24)31(34)35)39-30(33)23-10-15-26(16-11-23)37-18-6-5-7-19-38-29(32)21(2)3/h8-17,20H,2,4-7,18-19H2,1,3H3 |
| InChIKey | QRBYYGBLGWNWAT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|