C35H41NO6 — CID 11103778
[4-[(2S)-hex-5-en-2-yl]oxy-3-nitrophenyl] 4-(4-dec-9-enoxyphenyl)benzoate (PubChem CID 11103778) has the molecular formula C35H41NO6 and a molecular weight of 571.71 g/mol. Its IUPAC name is [4-[(2S)-hex-5-en-2-yl]oxy-3-nitrophenyl] 4-(4-dec-9-enoxyphenyl)benzoate.
| Compound Name | [4-[(2S)-hex-5-en-2-yl]oxy-3-nitrophenyl] 4-(4-dec-9-enoxyphenyl)benzoate |
|---|---|
| PubChem CID | 11103778 |
| Molecular Formula | C35H41NO6 |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | [4-[(2S)-hex-5-en-2-yl]oxy-3-nitrophenyl] 4-(4-dec-9-enoxyphenyl)benzoate |
| SMILES | C=CCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(O[C@@H](C)CCC=C)c([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C35H41NO6/c1-4-6-8-9-10-11-12-13-25-40-31-21-19-29(20-22-31)28-15-17-30(18-16-28)35(37)42-32-23-24-34(33(26-32)36(38)39)41-27(3)14-7-5-2/h4-5,15-24,26-27H,1-2,6-14,25H2,3H3/t27-/m0/s1 |
| InChIKey | JMRMTKGXHVKRNT-MHZLTWQESA-N |
| XLogP | 9.51 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|