C32H39NO8 — CID 101104004
4-[4-[10-[2-(4-hydroxy-2-nitrophenoxy)propoxy]decoxy]phenyl]benzoic acid (PubChem CID 101104004) has the molecular formula C32H39NO8 and a molecular weight of 565.66 g/mol. Its IUPAC name is 4-[4-[10-[2-(4-hydroxy-2-nitrophenoxy)propoxy]decoxy]phenyl]benzoic acid.
| Compound Name | 4-[4-[10-[2-(4-hydroxy-2-nitrophenoxy)propoxy]decoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 101104004 |
| Molecular Formula | C32H39NO8 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 4-[4-[10-[2-(4-hydroxy-2-nitrophenoxy)propoxy]decoxy]phenyl]benzoic acid |
| SMILES | CC(COCCCCCCCCCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1)Oc1ccc(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H39NO8/c1-24(41-31-19-16-28(34)22-30(31)33(37)38)23-39-20-8-6-4-2-3-5-7-9-21-40-29-17-14-26(15-18-29)25-10-12-27(13-11-25)32(35)36/h10-19,22,24,34H,2-9,20-21,23H2,1H3,(H,35,36) |
| InChIKey | XBCPHVZGEOCMOZ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|